C14H27N3O3S — CID 106050793
N-(3-methoxy-2-methylpropyl)-1-methyl-5-(propylaminomethyl)pyrrole-3-sulfonamide (PubChem CID 106050793) has the molecular formula C14H27N3O3S and a molecular weight of 317.46 g/mol. Its IUPAC name is N-(3-methoxy-2-methylpropyl)-1-methyl-5-(propylaminomethyl)pyrrole-3-sulfonamide.
| Compound Name | N-(3-methoxy-2-methylpropyl)-1-methyl-5-(propylaminomethyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106050793 |
| Molecular Formula | C14H27N3O3S |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | N-(3-methoxy-2-methylpropyl)-1-methyl-5-(propylaminomethyl)pyrrole-3-sulfonamide |
| SMILES | CCCNCc1cc(S(=O)(=O)NCC(C)COC)cn1C |
| InChI | InChI=1S/C14H27N3O3S/c1-5-6-15-9-13-7-14(10-17(13)3)21(18,19)16-8-12(2)11-20-4/h7,10,12,15-16H,5-6,8-9,11H2,1-4H3 |
| InChIKey | KVXMTHPLXUEPAS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|