C12H19F3N2O3S — CID 115522721
1-ethyl-5-(hydroxymethyl)-N-(5,5,5-trifluoropentyl)pyrrole-3-sulfonamide (PubChem CID 115522721) has the molecular formula C12H19F3N2O3S and a molecular weight of 328.36 g/mol. Its IUPAC name is 1-ethyl-5-(hydroxymethyl)-N-(5,5,5-trifluoropentyl)pyrrole-3-sulfonamide.
| Compound Name | 1-ethyl-5-(hydroxymethyl)-N-(5,5,5-trifluoropentyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 115522721 |
| Molecular Formula | C12H19F3N2O3S |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-ethyl-5-(hydroxymethyl)-N-(5,5,5-trifluoropentyl)pyrrole-3-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCCCCC(F)(F)F)cc1CO |
| InChI | InChI=1S/C12H19F3N2O3S/c1-2-17-8-11(7-10(17)9-18)21(19,20)16-6-4-3-5-12(13,14)15/h7-8,16,18H,2-6,9H2,1H3 |
| InChIKey | BEZNNMAGIHSRQJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|