C11H18F3N3O2S — CID 115522822
5-(aminomethyl)-1-ethyl-N-(4,4,4-trifluorobutyl)pyrrole-3-sulfonamide (PubChem CID 115522822) has the molecular formula C11H18F3N3O2S and a molecular weight of 313.35 g/mol. Its IUPAC name is 5-(aminomethyl)-1-ethyl-N-(4,4,4-trifluorobutyl)pyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-1-ethyl-N-(4,4,4-trifluorobutyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 115522822 |
| Molecular Formula | C11H18F3N3O2S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 5-(aminomethyl)-1-ethyl-N-(4,4,4-trifluorobutyl)pyrrole-3-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCCCC(F)(F)F)cc1CN |
| InChI | InChI=1S/C11H18F3N3O2S/c1-2-17-8-10(6-9(17)7-15)20(18,19)16-5-3-4-11(12,13)14/h6,8,16H,2-5,7,15H2,1H3 |
| InChIKey | KVJFGYFNSNHAKJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|