C19H27NO4S2 — CID 122160835
N-(5-hydroxy-3-thiophen-3-ylpentyl)-4-(2-methylpropoxy)benzenesulfonamide (PubChem CID 122160835) has the molecular formula C19H27NO4S2 and a molecular weight of 397.56 g/mol. Its IUPAC name is N-(5-hydroxy-3-thiophen-3-ylpentyl)-4-(2-methylpropoxy)benzenesulfonamide.
| Compound Name | N-(5-hydroxy-3-thiophen-3-ylpentyl)-4-(2-methylpropoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 122160835 |
| Molecular Formula | C19H27NO4S2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-(5-hydroxy-3-thiophen-3-ylpentyl)-4-(2-methylpropoxy)benzenesulfonamide |
| SMILES | CC(C)COc1ccc(S(=O)(=O)NCCC(CCO)c2ccsc2)cc1 |
| InChI | InChI=1S/C19H27NO4S2/c1-15(2)13-24-18-3-5-19(6-4-18)26(22,23)20-10-7-16(8-11-21)17-9-12-25-14-17/h3-6,9,12,14-16,20-21H,7-8,10-11,13H2,1-2H3 |
| InChIKey | RCBLFTVXMZKSLH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |