C27H44N2O3 — CID 123960466
ethyl 16-(2-phenylethylcarbamoylamino)hexadec-6-enoate (PubChem CID 123960466) has the molecular formula C27H44N2O3 and a molecular weight of 444.66 g/mol. Its IUPAC name is ethyl 16-(2-phenylethylcarbamoylamino)hexadec-6-enoate.
| Compound Name | ethyl 16-(2-phenylethylcarbamoylamino)hexadec-6-enoate |
|---|---|
| PubChem CID | 123960466 |
| Molecular Formula | C27H44N2O3 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.34 |
| IUPAC Name | ethyl 16-(2-phenylethylcarbamoylamino)hexadec-6-enoate |
| SMILES | CCOC(=O)CCCCC=CCCCCCCCCCNC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C27H44N2O3/c1-2-32-26(30)21-17-12-10-8-6-4-3-5-7-9-11-13-18-23-28-27(31)29-24-22-25-19-15-14-16-20-25/h6,8,14-16,19-20H,2-5,7,9-13,17-18,21-24H2,1H3,(H2,28,29,31) |
| InChIKey | XESGTYPIDHNLNS-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|