C29H38N2O5 — CID 68610916
3-[(E)-3-[4-[(4-propylcyclohexyl)methoxy]phenyl]prop-2-enoyl]oxypropyl 3,5-diaminobenzoate (PubChem CID 68610916) has the molecular formula C29H38N2O5 and a molecular weight of 494.63 g/mol. Its IUPAC name is 3-[(E)-3-[4-[(4-propylcyclohexyl)methoxy]phenyl]prop-2-enoyl]oxypropyl 3,5-diaminobenzoate.
| Compound Name | 3-[(E)-3-[4-[(4-propylcyclohexyl)methoxy]phenyl]prop-2-enoyl]oxypropyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 68610916 |
| Molecular Formula | C29H38N2O5 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | 3-[(E)-3-[4-[(4-propylcyclohexyl)methoxy]phenyl]prop-2-enoyl]oxypropyl 3,5-diaminobenzoate |
| SMILES | CCCC1CCC(COc2ccc(/C=C/C(=O)OCCCOC(=O)c3cc(N)cc(N)c3)cc2)CC1 |
| InChI | InChI=1S/C29H38N2O5/c1-2-4-21-5-7-23(8-6-21)20-36-27-12-9-22(10-13-27)11-14-28(32)34-15-3-16-35-29(33)24-17-25(30)19-26(31)18-24/h9-14,17-19,21,23H,2-8,15-16,20,30-31H2,1H3/b14-11+ |
| InChIKey | PUVLSFGMWCEZJR-SDNWHVSQSA-N |
| XLogP | 5.64 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|