C29H35F3N2O6 — CID 68612654
2-[(E)-3-[4-[[4-(4,4,4-trifluorobutoxy)cyclohexyl]methoxy]phenyl]prop-2-enoyl]oxyethyl 3,5-diaminobenzoate (PubChem CID 68612654) has the molecular formula C29H35F3N2O6 and a molecular weight of 564.60 g/mol. Its IUPAC name is 2-[(E)-3-[4-[[4-(4,4,4-trifluorobutoxy)cyclohexyl]methoxy]phenyl]prop-2-enoyl]oxyethyl 3,5-diaminobenzoate.
| Compound Name | 2-[(E)-3-[4-[[4-(4,4,4-trifluorobutoxy)cyclohexyl]methoxy]phenyl]prop-2-enoyl]oxyethyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 68612654 |
| Molecular Formula | C29H35F3N2O6 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 2-[(E)-3-[4-[[4-(4,4,4-trifluorobutoxy)cyclohexyl]methoxy]phenyl]prop-2-enoyl]oxyethyl 3,5-diaminobenzoate |
| SMILES | Nc1cc(N)cc(C(=O)OCCOC(=O)/C=C/c2ccc(OCC3CCC(OCCCC(F)(F)F)CC3)cc2)c1 |
| InChI | InChI=1S/C29H35F3N2O6/c30-29(31,32)12-1-13-37-25-9-4-21(5-10-25)19-40-26-7-2-20(3-8-26)6-11-27(35)38-14-15-39-28(36)22-16-23(33)18-24(34)17-22/h2-3,6-8,11,16-18,21,25H,1,4-5,9-10,12-15,19,33-34H2/b11-6+ |
| InChIKey | ZMQAMIOPGOSGGZ-IZZDOVSWSA-N |
| XLogP | 5.56 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|