C27H34N2O5 — CID 68613360
2-[3-[4-[(4-ethylcyclohexyl)methoxy]phenyl]prop-2-enoyloxy]ethyl 3,5-diaminobenzoate (PubChem CID 68613360) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is 2-[3-[4-[(4-ethylcyclohexyl)methoxy]phenyl]prop-2-enoyloxy]ethyl 3,5-diaminobenzoate.
| Compound Name | 2-[3-[4-[(4-ethylcyclohexyl)methoxy]phenyl]prop-2-enoyloxy]ethyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 68613360 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 2-[3-[4-[(4-ethylcyclohexyl)methoxy]phenyl]prop-2-enoyloxy]ethyl 3,5-diaminobenzoate |
| SMILES | CCC1CCC(COc2ccc(C=CC(=O)OCCOC(=O)c3cc(N)cc(N)c3)cc2)CC1 |
| InChI | InChI=1S/C27H34N2O5/c1-2-19-3-5-21(6-4-19)18-34-25-10-7-20(8-11-25)9-12-26(30)32-13-14-33-27(31)22-15-23(28)17-24(29)16-22/h7-12,15-17,19,21H,2-6,13-14,18,28-29H2,1H3 |
| InChIKey | RZKIJNNQABXIKL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|