C28H36N2O5 — CID 91434731
3,5-diamino-2-[2-[3-[4-[(4-propylcyclohexyl)methoxy]phenyl]prop-2-enoyloxy]ethyl]benzoic acid (PubChem CID 91434731) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is 3,5-diamino-2-[2-[3-[4-[(4-propylcyclohexyl)methoxy]phenyl]prop-2-enoyloxy]ethyl]benzoic acid.
| Compound Name | 3,5-diamino-2-[2-[3-[4-[(4-propylcyclohexyl)methoxy]phenyl]prop-2-enoyloxy]ethyl]benzoic acid |
|---|---|
| PubChem CID | 91434731 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 3,5-diamino-2-[2-[3-[4-[(4-propylcyclohexyl)methoxy]phenyl]prop-2-enoyloxy]ethyl]benzoic acid |
| SMILES | CCCC1CCC(COc2ccc(C=CC(=O)OCCc3c(N)cc(N)cc3C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C28H36N2O5/c1-2-3-19-4-6-21(7-5-19)18-35-23-11-8-20(9-12-23)10-13-27(31)34-15-14-24-25(28(32)33)16-22(29)17-26(24)30/h8-13,16-17,19,21H,2-7,14-15,18,29-30H2,1H3,(H,32,33) |
| InChIKey | FHCPQEGKNIJNKP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|