C25H36O4 — CID 137415709
2-[(E)-3-[4-(4-propylcyclohexyl)phenyl]prop-2-enoyl]oxyethyl 2,2-dimethylpropanoate (PubChem CID 137415709) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is 2-[(E)-3-[4-(4-propylcyclohexyl)phenyl]prop-2-enoyl]oxyethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(E)-3-[4-(4-propylcyclohexyl)phenyl]prop-2-enoyl]oxyethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 137415709 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 2-[(E)-3-[4-(4-propylcyclohexyl)phenyl]prop-2-enoyl]oxyethyl 2,2-dimethylpropanoate |
| SMILES | CCCC1CCC(c2ccc(/C=C/C(=O)OCCOC(=O)C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C25H36O4/c1-5-6-19-7-12-21(13-8-19)22-14-9-20(10-15-22)11-16-23(26)28-17-18-29-24(27)25(2,3)4/h9-11,14-16,19,21H,5-8,12-13,17-18H2,1-4H3/b16-11+ |
| InChIKey | ZRRDYDNDVAMAQO-LFIBNONCSA-N |
| XLogP | 5.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|