C29H34O4 — CID 54500805
6-[4-[4-[4-(3-methoxy-3-oxoprop-1-enyl)phenyl]phenyl]cyclohexyl]-2-methylhex-2-enoic acid (PubChem CID 54500805) has the molecular formula C29H34O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is 6-[4-[4-[4-(3-methoxy-3-oxoprop-1-enyl)phenyl]phenyl]cyclohexyl]-2-methylhex-2-enoic acid.
| Compound Name | 6-[4-[4-[4-(3-methoxy-3-oxoprop-1-enyl)phenyl]phenyl]cyclohexyl]-2-methylhex-2-enoic acid |
|---|---|
| PubChem CID | 54500805 |
| Molecular Formula | C29H34O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 6-[4-[4-[4-(3-methoxy-3-oxoprop-1-enyl)phenyl]phenyl]cyclohexyl]-2-methylhex-2-enoic acid |
| SMILES | COC(=O)C=Cc1ccc(-c2ccc(C3CCC(CCCC=C(C)C(=O)O)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H34O4/c1-21(29(31)32)5-3-4-6-22-7-12-24(13-8-22)26-16-18-27(19-17-26)25-14-9-23(10-15-25)11-20-28(30)33-2/h5,9-11,14-20,22,24H,3-4,6-8,12-13H2,1-2H3,(H,31,32) |
| InChIKey | YCHAKMFJENSIRI-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|