C19H27NO2 — CID 70462906
[4-(4-hex-5-enylcyclohexyl)phenyl]carbamic acid (PubChem CID 70462906) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is [4-(4-hex-5-enylcyclohexyl)phenyl]carbamic acid.
| Compound Name | [4-(4-hex-5-enylcyclohexyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 70462906 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | [4-(4-hex-5-enylcyclohexyl)phenyl]carbamic acid |
| SMILES | C=CCCCCC1CCC(c2ccc(NC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C19H27NO2/c1-2-3-4-5-6-15-7-9-16(10-8-15)17-11-13-18(14-12-17)20-19(21)22/h2,11-16,20H,1,3-10H2,(H,21,22) |
| InChIKey | FBUMOQTVIWEKGY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|