C15H14F2O4 — CID 70289547
2-[(3,4-difluorophenyl)methylidene]-4-(2-methylprop-2-enoyloxy)butanoic acid (PubChem CID 70289547) has the molecular formula C15H14F2O4 and a molecular weight of 296.27 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)methylidene]-4-(2-methylprop-2-enoyloxy)butanoic acid.
| Compound Name | 2-[(3,4-difluorophenyl)methylidene]-4-(2-methylprop-2-enoyloxy)butanoic acid |
|---|---|
| PubChem CID | 70289547 |
| Molecular Formula | C15H14F2O4 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-[(3,4-difluorophenyl)methylidene]-4-(2-methylprop-2-enoyloxy)butanoic acid |
| SMILES | C=C(C)C(=O)OCCC(=Cc1ccc(F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C15H14F2O4/c1-9(2)15(20)21-6-5-11(14(18)19)7-10-3-4-12(16)13(17)8-10/h3-4,7-8H,1,5-6H2,2H3,(H,18,19) |
| InChIKey | QVFOXENTSWLZDI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|