C27H30O7 — CID 70290713
2-[[4-[4-[(2S)-2-methylbutoxy]benzoyl]oxyphenyl]methylidene]-4-(2-methylprop-2-enoyloxy)butanoic acid (PubChem CID 70290713) has the molecular formula C27H30O7 and a molecular weight of 466.53 g/mol. Its IUPAC name is 2-[[4-[4-[(2S)-2-methylbutoxy]benzoyl]oxyphenyl]methylidene]-4-(2-methylprop-2-enoyloxy)butanoic acid.
| Compound Name | 2-[[4-[4-[(2S)-2-methylbutoxy]benzoyl]oxyphenyl]methylidene]-4-(2-methylprop-2-enoyloxy)butanoic acid |
|---|---|
| PubChem CID | 70290713 |
| Molecular Formula | C27H30O7 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 2-[[4-[4-[(2S)-2-methylbutoxy]benzoyl]oxyphenyl]methylidene]-4-(2-methylprop-2-enoyloxy)butanoic acid |
| SMILES | C=C(C)C(=O)OCCC(=Cc1ccc(OC(=O)c2ccc(OC[C@@H](C)CC)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C27H30O7/c1-5-19(4)17-33-23-12-8-21(9-13-23)27(31)34-24-10-6-20(7-11-24)16-22(25(28)29)14-15-32-26(30)18(2)3/h6-13,16,19H,2,5,14-15,17H2,1,3-4H3,(H,28,29)/t19-/m0/s1 |
| InChIKey | LBDAVDANUHRFPS-IBGZPJMESA-N |
| XLogP | 5.31 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|