C17H13F3O2S — CID 59066667
(E)-3-[4-(2-methylphenyl)sulfanyl-3-(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 59066667) has the molecular formula C17H13F3O2S and a molecular weight of 338.35 g/mol. Its IUPAC name is (E)-3-[4-(2-methylphenyl)sulfanyl-3-(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(2-methylphenyl)sulfanyl-3-(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59066667 |
| Molecular Formula | C17H13F3O2S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | (E)-3-[4-(2-methylphenyl)sulfanyl-3-(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | Cc1ccccc1Sc1ccc(/C=C/C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C17H13F3O2S/c1-11-4-2-3-5-14(11)23-15-8-6-12(7-9-16(21)22)10-13(15)17(18,19)20/h2-10H,1H3,(H,21,22)/b9-7+ |
| InChIKey | XDWYYPHWGHMRJG-VQHVLOKHSA-N |
| XLogP | 5.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|