C24H26F3NOS — CID 11676406
(E)-N-cyclopentyl-3-[4-(2-propan-2-ylphenyl)sulfanyl-3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 11676406) has the molecular formula C24H26F3NOS and a molecular weight of 433.54 g/mol. Its IUPAC name is (E)-N-cyclopentyl-3-[4-(2-propan-2-ylphenyl)sulfanyl-3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-cyclopentyl-3-[4-(2-propan-2-ylphenyl)sulfanyl-3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 11676406 |
| Molecular Formula | C24H26F3NOS |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (E)-N-cyclopentyl-3-[4-(2-propan-2-ylphenyl)sulfanyl-3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CC(C)c1ccccc1Sc1ccc(/C=C/C(=O)NC2CCCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H26F3NOS/c1-16(2)19-9-5-6-10-21(19)30-22-13-11-17(15-20(22)24(25,26)27)12-14-23(29)28-18-7-3-4-8-18/h5-6,9-16,18H,3-4,7-8H2,1-2H3,(H,28,29)/b14-12+ |
| InChIKey | FQQYTXORBSOVEU-WYMLVPIESA-N |
| XLogP | 7.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|