C11H16FNO — CID 81105678
2-(3-fluoropropoxy)-3,5-dimethylaniline (PubChem CID 81105678) has the molecular formula C11H16FNO and a molecular weight of 197.25 g/mol. Its IUPAC name is 2-(3-fluoropropoxy)-3,5-dimethylaniline.
| Compound Name | 2-(3-fluoropropoxy)-3,5-dimethylaniline |
|---|---|
| PubChem CID | 81105678 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-(3-fluoropropoxy)-3,5-dimethylaniline |
| SMILES | Cc1cc(C)c(OCCCF)c(N)c1 |
| InChI | InChI=1S/C11H16FNO/c1-8-6-9(2)11(10(13)7-8)14-5-3-4-12/h6-7H,3-5,13H2,1-2H3 |
| InChIKey | QFIXFVFUWOURSE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|