C17H23Cl — CID 83931918
6-chloro-7-[(Z)-2-methylhex-3-enyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 83931918) has the molecular formula C17H23Cl and a molecular weight of 262.82 g/mol. Its IUPAC name is 6-chloro-7-[(Z)-2-methylhex-3-enyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-chloro-7-[(Z)-2-methylhex-3-enyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 83931918 |
| Molecular Formula | C17H23Cl |
| Molecular Weight | 262.82 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 6-chloro-7-[(Z)-2-methylhex-3-enyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC/C=C\C(C)Cc1cc2c(cc1Cl)CCCC2 |
| InChI | InChI=1S/C17H23Cl/c1-3-4-7-13(2)10-16-11-14-8-5-6-9-15(14)12-17(16)18/h4,7,11-13H,3,5-6,8-10H2,1-2H3/b7-4- |
| InChIKey | OESWJLMPZAJQRQ-DAXSKMNVSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.82 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|