3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid

C14H17ClO2 — CID 83957920

IUPAC3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid
SMILESCC(CC(=O)O)c1cc2c(cc1Cl)CCCC2
InChIInChI=1S/C14H17ClO2/c1-9(6-14(16)17)12-7-10-4-2-3-5-11(10)8-13(12)15/h7-9H,2-6H2,1H3,(H,16,17)
InChIKeyRCANIJCSZVUWFF-UHFFFAOYSA-N
MW252.74 g/mol
LogP3.80
Rot. Bonds3

About 3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid

3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid (PubChem CID 83957920) has the molecular formula C14H17ClO2 and a molecular weight of 252.74 g/mol. Its IUPAC name is 3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid.

Molecular Properties

Compound Name3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid
PubChem CID83957920
Molecular FormulaC14H17ClO2
Molecular Weight252.74 g/mol
Exact Mass252.09
IUPAC Name3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid
SMILESCC(CC(=O)O)c1cc2c(cc1Cl)CCCC2
InChIInChI=1S/C14H17ClO2/c1-9(6-14(16)17)12-7-10-4-2-3-5-11(10)8-13(12)15/h7-9H,2-6H2,1H3,(H,16,17)
InChIKeyRCANIJCSZVUWFF-UHFFFAOYSA-N
XLogP3.80
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.74
LogP ≤ 53.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid?
The IUPAC name of 3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid (CID 83957920) is 3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid.
What is the SMILES notation for 3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid?
The canonical SMILES for 3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid is CC(CC(=O)O)c1cc2c(cc1Cl)CCCC2.
What is the InChIKey of 3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid?
The InChIKey is RCANIJCSZVUWFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClO2/c1-9(6-14(16)17)12-7-10-4-2-3-5-11(10)8-13(12)15/h7-9H,2-6H2,1H3,(H,16,17).
What are the key properties of 3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid?
3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid has a molecular weight of 252.74 g/mol, XLogP of 3.80, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid is sourced from PubChem (CID 83957920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).