C14H17ClO2 — CID 83957920
3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid (PubChem CID 83957920) has the molecular formula C14H17ClO2 and a molecular weight of 252.74 g/mol. Its IUPAC name is 3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid.
| Compound Name | 3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid |
|---|---|
| PubChem CID | 83957920 |
| Molecular Formula | C14H17ClO2 |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid |
| SMILES | CC(CC(=O)O)c1cc2c(cc1Cl)CCCC2 |
| InChI | InChI=1S/C14H17ClO2/c1-9(6-14(16)17)12-7-10-4-2-3-5-11(10)8-13(12)15/h7-9H,2-6H2,1H3,(H,16,17) |
| InChIKey | RCANIJCSZVUWFF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |