C13H17Cl — CID 66034063
5-(3-chloro-2-methylpropyl)-2,3-dihydro-1H-indene (PubChem CID 66034063) has the molecular formula C13H17Cl and a molecular weight of 208.73 g/mol. Its IUPAC name is 5-(3-chloro-2-methylpropyl)-2,3-dihydro-1H-indene.
| Compound Name | 5-(3-chloro-2-methylpropyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 66034063 |
| Molecular Formula | C13H17Cl |
| Molecular Weight | 208.73 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 5-(3-chloro-2-methylpropyl)-2,3-dihydro-1H-indene |
| SMILES | CC(CCl)Cc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H17Cl/c1-10(9-14)7-11-5-6-12-3-2-4-13(12)8-11/h5-6,8,10H,2-4,7,9H2,1H3 |
| InChIKey | ZPVUMUCIRSKRDC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.73 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|