C19H20Cl2 — CID 66048824
5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-2,3-dihydro-1H-indene (PubChem CID 66048824) has the molecular formula C19H20Cl2 and a molecular weight of 319.27 g/mol. Its IUPAC name is 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-2,3-dihydro-1H-indene.
| Compound Name | 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 66048824 |
| Molecular Formula | C19H20Cl2 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-2,3-dihydro-1H-indene |
| SMILES | ClCC(Cc1ccc2c(c1)CCC2)Cc1ccccc1Cl |
| InChI | InChI=1S/C19H20Cl2/c20-13-15(12-18-4-1-2-7-19(18)21)10-14-8-9-16-5-3-6-17(16)11-14/h1-2,4,7-9,11,15H,3,5-6,10,12-13H2 |
| InChIKey | AUISCXQGZKCTTA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|