C16H23Cl — CID 66033857
5-[2-(chloromethyl)-4-methylpentyl]-2,3-dihydro-1H-indene (PubChem CID 66033857) has the molecular formula C16H23Cl and a molecular weight of 250.81 g/mol. Its IUPAC name is 5-[2-(chloromethyl)-4-methylpentyl]-2,3-dihydro-1H-indene.
| Compound Name | 5-[2-(chloromethyl)-4-methylpentyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 66033857 |
| Molecular Formula | C16H23Cl |
| Molecular Weight | 250.81 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 5-[2-(chloromethyl)-4-methylpentyl]-2,3-dihydro-1H-indene |
| SMILES | CC(C)CC(CCl)Cc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H23Cl/c1-12(2)8-14(11-17)9-13-6-7-15-4-3-5-16(15)10-13/h6-7,10,12,14H,3-5,8-9,11H2,1-2H3 |
| InChIKey | ZMMADVKEJGINFY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.81 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|