C12H10Cl3NO — CID 106692129
1-(5-chlorofuran-2-yl)-2-(2,5-dichlorophenyl)ethanamine (PubChem CID 106692129) has the molecular formula C12H10Cl3NO and a molecular weight of 290.58 g/mol. Its IUPAC name is 1-(5-chlorofuran-2-yl)-2-(2,5-dichlorophenyl)ethanamine.
| Compound Name | 1-(5-chlorofuran-2-yl)-2-(2,5-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 106692129 |
| Molecular Formula | C12H10Cl3NO |
| Molecular Weight | 290.58 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | 1-(5-chlorofuran-2-yl)-2-(2,5-dichlorophenyl)ethanamine |
| SMILES | NC(Cc1cc(Cl)ccc1Cl)c1ccc(Cl)o1 |
| InChI | InChI=1S/C12H10Cl3NO/c13-8-1-2-9(14)7(5-8)6-10(16)11-3-4-12(15)17-11/h1-5,10H,6,16H2 |
| InChIKey | ALQNPKRFRVAFHD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |