C12H15FN4 — CID 112735901
2-(4-fluoro-2-methylphenyl)-1-(1-methyltriazol-4-yl)ethanamine (PubChem CID 112735901) has the molecular formula C12H15FN4 and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-(4-fluoro-2-methylphenyl)-1-(1-methyltriazol-4-yl)ethanamine.
| Compound Name | 2-(4-fluoro-2-methylphenyl)-1-(1-methyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 112735901 |
| Molecular Formula | C12H15FN4 |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2-(4-fluoro-2-methylphenyl)-1-(1-methyltriazol-4-yl)ethanamine |
| SMILES | Cc1cc(F)ccc1CC(N)c1cn(C)nn1 |
| InChI | InChI=1S/C12H15FN4/c1-8-5-10(13)4-3-9(8)6-11(14)12-7-17(2)16-15-12/h3-5,7,11H,6,14H2,1-2H3 |
| InChIKey | KRHJPDVWLBFYID-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |