C9H7ClN2OS — CID 54170926
(2-chloro-3-pyridinyl)-(1,3-thiazol-2-yl)methanol (PubChem CID 54170926) has the molecular formula C9H7ClN2OS and a molecular weight of 226.69 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl)-(1,3-thiazol-2-yl)methanol.
| Compound Name | (2-chloro-3-pyridinyl)-(1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 54170926 |
| Molecular Formula | C9H7ClN2OS |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | (2-chloro-3-pyridinyl)-(1,3-thiazol-2-yl)methanol |
| SMILES | OC(c1nccs1)c1cccnc1Cl |
| InChI | InChI=1S/C9H7ClN2OS/c10-8-6(2-1-3-11-8)7(13)9-12-4-5-14-9/h1-5,7,13H |
| InChIKey | OUYWMQDWZUYPED-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|