C10H7BrFNOS — CID 86730392
(3-bromo-2-fluorophenyl)-(1,3-thiazol-2-yl)methanol (PubChem CID 86730392) has the molecular formula C10H7BrFNOS and a molecular weight of 288.14 g/mol. Its IUPAC name is (3-bromo-2-fluorophenyl)-(1,3-thiazol-2-yl)methanol.
| Compound Name | (3-bromo-2-fluorophenyl)-(1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 86730392 |
| Molecular Formula | C10H7BrFNOS |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 286.94 |
| IUPAC Name | (3-bromo-2-fluorophenyl)-(1,3-thiazol-2-yl)methanol |
| SMILES | OC(c1nccs1)c1cccc(Br)c1F |
| InChI | InChI=1S/C10H7BrFNOS/c11-7-3-1-2-6(8(7)12)9(14)10-13-4-5-15-10/h1-5,9,14H |
| InChIKey | LUHYZMFEBXFXMU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |