C8H9N5OS — CID 78945961
N-[1-(1,3-thiazol-2-yl)ethyl]-2H-triazole-4-carboxamide (PubChem CID 78945961) has the molecular formula C8H9N5OS and a molecular weight of 223.26 g/mol. Its IUPAC name is N-[1-(1,3-thiazol-2-yl)ethyl]-2H-triazole-4-carboxamide.
| Compound Name | N-[1-(1,3-thiazol-2-yl)ethyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 78945961 |
| Molecular Formula | C8H9N5OS |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | N-[1-(1,3-thiazol-2-yl)ethyl]-2H-triazole-4-carboxamide |
| SMILES | CC(NC(=O)c1cn[nH]n1)c1nccs1 |
| InChI | InChI=1S/C8H9N5OS/c1-5(8-9-2-3-15-8)11-7(14)6-4-10-13-12-6/h2-5H,1H3,(H,11,14)(H,10,12,13) |
| InChIKey | NPOMZCNQNOYHPZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |