C10H9ClN4OS — CID 107257634
5-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]pyrazine-2-carboxamide (PubChem CID 107257634) has the molecular formula C10H9ClN4OS and a molecular weight of 268.73 g/mol. Its IUPAC name is 5-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]pyrazine-2-carboxamide.
| Compound Name | 5-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107257634 |
| Molecular Formula | C10H9ClN4OS |
| Molecular Weight | 268.73 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 5-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]pyrazine-2-carboxamide |
| SMILES | CC(NC(=O)c1cnc(Cl)cn1)c1nccs1 |
| InChI | InChI=1S/C10H9ClN4OS/c1-6(10-12-2-3-17-10)15-9(16)7-4-14-8(11)5-13-7/h2-6H,1H3,(H,15,16) |
| InChIKey | SKNCQQIKQRUZRV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.73 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |