C14H23N3OS — CID 72845666
2-(1-ethylpiperidin-4-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]acetamide (PubChem CID 72845666) has the molecular formula C14H23N3OS and a molecular weight of 281.42 g/mol. Its IUPAC name is 2-(1-ethylpiperidin-4-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]acetamide.
| Compound Name | 2-(1-ethylpiperidin-4-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 72845666 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-(1-ethylpiperidin-4-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]acetamide |
| SMILES | CCN1CCC(CC(=O)NC(C)c2nccs2)CC1 |
| InChI | InChI=1S/C14H23N3OS/c1-3-17-7-4-12(5-8-17)10-13(18)16-11(2)14-15-6-9-19-14/h6,9,11-12H,3-5,7-8,10H2,1-2H3,(H,16,18) |
| InChIKey | XZZPFLKYIRKUDC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |