C13H12Cl2N2O2S — CID 71994849
2-(3,5-dichlorophenoxy)-N-[1-(1,3-thiazol-2-yl)ethyl]acetamide (PubChem CID 71994849) has the molecular formula C13H12Cl2N2O2S and a molecular weight of 331.22 g/mol. Its IUPAC name is 2-(3,5-dichlorophenoxy)-N-[1-(1,3-thiazol-2-yl)ethyl]acetamide.
| Compound Name | 2-(3,5-dichlorophenoxy)-N-[1-(1,3-thiazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 71994849 |
| Molecular Formula | C13H12Cl2N2O2S |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 2-(3,5-dichlorophenoxy)-N-[1-(1,3-thiazol-2-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)COc1cc(Cl)cc(Cl)c1)c1nccs1 |
| InChI | InChI=1S/C13H12Cl2N2O2S/c1-8(13-16-2-3-20-13)17-12(18)7-19-11-5-9(14)4-10(15)6-11/h2-6,8H,7H2,1H3,(H,17,18) |
| InChIKey | KJVQFRXUHNCKNZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |