C12H12N2O3S — CID 113232782
2,4-dihydroxy-N-[1-(1,3-thiazol-2-yl)ethyl]benzamide (PubChem CID 113232782) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 2,4-dihydroxy-N-[1-(1,3-thiazol-2-yl)ethyl]benzamide.
| Compound Name | 2,4-dihydroxy-N-[1-(1,3-thiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 113232782 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2,4-dihydroxy-N-[1-(1,3-thiazol-2-yl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(O)cc1O)c1nccs1 |
| InChI | InChI=1S/C12H12N2O3S/c1-7(12-13-4-5-18-12)14-11(17)9-3-2-8(15)6-10(9)16/h2-7,15-16H,1H3,(H,14,17) |
| InChIKey | NRBDOXMOVODODH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |