C27H34N4O3S — CID 87898779
1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,5-dimethylphenyl]-3-(2-piperidin-2-ylethyl)thiourea (PubChem CID 87898779) has the molecular formula C27H34N4O3S and a molecular weight of 494.66 g/mol. Its IUPAC name is 1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,5-dimethylphenyl]-3-(2-piperidin-2-ylethyl)thiourea.
| Compound Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,5-dimethylphenyl]-3-(2-piperidin-2-ylethyl)thiourea |
|---|---|
| PubChem CID | 87898779 |
| Molecular Formula | C27H34N4O3S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,5-dimethylphenyl]-3-(2-piperidin-2-ylethyl)thiourea |
| SMILES | COc1cc2nccc(Oc3cc(C)c(NC(=S)NCCC4CCCCN4)cc3C)c2cc1OC |
| InChI | InChI=1S/C27H34N4O3S/c1-17-14-24(34-23-9-12-29-22-16-26(33-4)25(32-3)15-20(22)23)18(2)13-21(17)31-27(35)30-11-8-19-7-5-6-10-28-19/h9,12-16,19,28H,5-8,10-11H2,1-4H3,(H2,30,31,35) |
| InChIKey | LMUKPJRFUXLCHF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 76.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|