C11H18N2S — CID 127002628
N-(1-cyclobutyl-2-methylpropyl)-1,3-thiazol-2-amine (PubChem CID 127002628) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is N-(1-cyclobutyl-2-methylpropyl)-1,3-thiazol-2-amine.
| Compound Name | N-(1-cyclobutyl-2-methylpropyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 127002628 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-(1-cyclobutyl-2-methylpropyl)-1,3-thiazol-2-amine |
| SMILES | CC(C)C(Nc1nccs1)C1CCC1 |
| InChI | InChI=1S/C11H18N2S/c1-8(2)10(9-4-3-5-9)13-11-12-6-7-14-11/h6-10H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | NVGRPYNOYZOXFL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |