C8H10N4O2S — CID 107433315
5-oxo-N-(1,3-thiazol-2-yl)piperazine-2-carboxamide (PubChem CID 107433315) has the molecular formula C8H10N4O2S and a molecular weight of 226.26 g/mol. Its IUPAC name is 5-oxo-N-(1,3-thiazol-2-yl)piperazine-2-carboxamide.
| Compound Name | 5-oxo-N-(1,3-thiazol-2-yl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 107433315 |
| Molecular Formula | C8H10N4O2S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 5-oxo-N-(1,3-thiazol-2-yl)piperazine-2-carboxamide |
| SMILES | O=C1CNC(C(=O)Nc2nccs2)CN1 |
| InChI | InChI=1S/C8H10N4O2S/c13-6-4-10-5(3-11-6)7(14)12-8-9-1-2-15-8/h1-2,5,10H,3-4H2,(H,11,13)(H,9,12,14) |
| InChIKey | LSRZGBGSFFCRGW-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |