C12H11ClN4O2S — CID 107434143
N-(5-chloro-1,3-benzothiazol-4-yl)-5-oxopiperazine-2-carboxamide (PubChem CID 107434143) has the molecular formula C12H11ClN4O2S and a molecular weight of 310.77 g/mol. Its IUPAC name is N-(5-chloro-1,3-benzothiazol-4-yl)-5-oxopiperazine-2-carboxamide.
| Compound Name | N-(5-chloro-1,3-benzothiazol-4-yl)-5-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 107434143 |
| Molecular Formula | C12H11ClN4O2S |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | N-(5-chloro-1,3-benzothiazol-4-yl)-5-oxopiperazine-2-carboxamide |
| SMILES | O=C1CNC(C(=O)Nc2c(Cl)ccc3scnc23)CN1 |
| InChI | InChI=1S/C12H11ClN4O2S/c13-6-1-2-8-11(16-5-20-8)10(6)17-12(19)7-3-15-9(18)4-14-7/h1-2,5,7,14H,3-4H2,(H,15,18)(H,17,19) |
| InChIKey | GPDYJYATMBHYBI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |