C7H9N5O2S — CID 107437804
5-oxo-N-(thiadiazol-5-yl)piperazine-2-carboxamide (PubChem CID 107437804) has the molecular formula C7H9N5O2S and a molecular weight of 227.25 g/mol. Its IUPAC name is 5-oxo-N-(thiadiazol-5-yl)piperazine-2-carboxamide.
| Compound Name | 5-oxo-N-(thiadiazol-5-yl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 107437804 |
| Molecular Formula | C7H9N5O2S |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 5-oxo-N-(thiadiazol-5-yl)piperazine-2-carboxamide |
| SMILES | O=C1CNC(C(=O)Nc2cnns2)CN1 |
| InChI | InChI=1S/C7H9N5O2S/c13-5-2-8-4(1-9-5)7(14)11-6-3-10-12-15-6/h3-4,8H,1-2H2,(H,9,13)(H,11,14) |
| InChIKey | HLMGFOAVXPZPKF-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |