C9H13N5O2S — CID 107641827
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-oxopiperazine-2-carboxamide (PubChem CID 107641827) has the molecular formula C9H13N5O2S and a molecular weight of 255.30 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-oxopiperazine-2-carboxamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 107641827 |
| Molecular Formula | C9H13N5O2S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-oxopiperazine-2-carboxamide |
| SMILES | CCc1nnc(NC(=O)C2CNC(=O)CN2)s1 |
| InChI | InChI=1S/C9H13N5O2S/c1-2-7-13-14-9(17-7)12-8(16)5-3-11-6(15)4-10-5/h5,10H,2-4H2,1H3,(H,11,15)(H,12,14,16) |
| InChIKey | MADBWMSEXZKIEA-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |