C12H15N3O4S — CID 107435879
ethyl 2-[(5-oxopiperazine-2-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 107435879) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is ethyl 2-[(5-oxopiperazine-2-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(5-oxopiperazine-2-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 107435879 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | ethyl 2-[(5-oxopiperazine-2-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1ccsc1NC(=O)C1CNC(=O)CN1 |
| InChI | InChI=1S/C12H15N3O4S/c1-2-19-12(18)7-3-4-20-11(7)15-10(17)8-5-14-9(16)6-13-8/h3-4,8,13H,2,5-6H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | VWADCMMDIMYHJR-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |