C15H17NO5S — CID 6465288
6-[(3-ethoxycarbonylthiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 6465288) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is 6-[(3-ethoxycarbonylthiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[(3-ethoxycarbonylthiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 6465288 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 6-[(3-ethoxycarbonylthiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCOC(=O)c1ccsc1NC(=O)C1CC=CCC1C(=O)O |
| InChI | InChI=1S/C15H17NO5S/c1-2-21-15(20)11-7-8-22-13(11)16-12(17)9-5-3-4-6-10(9)14(18)19/h3-4,7-10H,2,5-6H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | LJHVRVDVIOHXCB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|