C18H23NO5S — CID 995593
(1S,6R)-6-[(3-ethoxycarbonyl-5-propylthiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 995593) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is (1S,6R)-6-[(3-ethoxycarbonyl-5-propylthiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[(3-ethoxycarbonyl-5-propylthiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 995593 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (1S,6R)-6-[(3-ethoxycarbonyl-5-propylthiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCCc1cc(C(=O)OCC)c(NC(=O)[C@@H]2CC=CC[C@@H]2C(=O)O)s1 |
| InChI | InChI=1S/C18H23NO5S/c1-3-7-11-10-14(18(23)24-4-2)16(25-11)19-15(20)12-8-5-6-9-13(12)17(21)22/h5-6,10,12-13H,3-4,7-9H2,1-2H3,(H,19,20)(H,21,22)/t12-,13+/m1/s1 |
| InChIKey | XEKVOGYDIDCAER-OLZOCXBDSA-N |
| XLogP | 3.48 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|