C13H17N3O2S — CID 17081286
1-cyclopentyl-5-oxo-N-(1,3-thiazol-2-yl)pyrrolidine-3-carboxamide (PubChem CID 17081286) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is 1-cyclopentyl-5-oxo-N-(1,3-thiazol-2-yl)pyrrolidine-3-carboxamide.
| Compound Name | 1-cyclopentyl-5-oxo-N-(1,3-thiazol-2-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17081286 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-cyclopentyl-5-oxo-N-(1,3-thiazol-2-yl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1nccs1)C1CC(=O)N(C2CCCC2)C1 |
| InChI | InChI=1S/C13H17N3O2S/c17-11-7-9(8-16(11)10-3-1-2-4-10)12(18)15-13-14-5-6-19-13/h5-6,9-10H,1-4,7-8H2,(H,14,15,18) |
| InChIKey | KGDNWKZVCILFRB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |