C14H14F2N4O2S2 — CID 18229970
N-[3-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-3-oxopropyl]-2,4-difluorobenzamide (PubChem CID 18229970) has the molecular formula C14H14F2N4O2S2 and a molecular weight of 372.42 g/mol. Its IUPAC name is N-[3-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-3-oxopropyl]-2,4-difluorobenzamide.
| Compound Name | N-[3-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-3-oxopropyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 18229970 |
| Molecular Formula | C14H14F2N4O2S2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | N-[3-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-3-oxopropyl]-2,4-difluorobenzamide |
| SMILES | CCSc1nnc(NC(=O)CCNC(=O)c2ccc(F)cc2F)s1 |
| InChI | InChI=1S/C14H14F2N4O2S2/c1-2-23-14-20-19-13(24-14)18-11(21)5-6-17-12(22)9-4-3-8(15)7-10(9)16/h3-4,7H,2,5-6H2,1H3,(H,17,22)(H,18,19,21) |
| InChIKey | JLRXZFFNYJCRBR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|