C22H26F2N4O3 — CID 55800405
N-[4-[[3-[[2-(dimethylamino)acetyl]amino]phenyl]methylamino]-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 55800405) has the molecular formula C22H26F2N4O3 and a molecular weight of 432.47 g/mol. Its IUPAC name is N-[4-[[3-[[2-(dimethylamino)acetyl]amino]phenyl]methylamino]-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[[3-[[2-(dimethylamino)acetyl]amino]phenyl]methylamino]-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 55800405 |
| Molecular Formula | C22H26F2N4O3 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | N-[4-[[3-[[2-(dimethylamino)acetyl]amino]phenyl]methylamino]-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | CN(C)CC(=O)Nc1cccc(CNC(=O)CCCNC(=O)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C22H26F2N4O3/c1-28(2)14-21(30)27-17-6-3-5-15(11-17)13-26-20(29)7-4-10-25-22(31)18-9-8-16(23)12-19(18)24/h3,5-6,8-9,11-12H,4,7,10,13-14H2,1-2H3,(H,25,31)(H,26,29)(H,27,30) |
| InChIKey | BZBGBIMWZMQHRT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|