C24H30F2N2O2 — CID 25143229
N'-(3,5-dimethylbenzoyl)-N'-[(3S)-2,2-dimethylhexan-3-yl]-2,6-difluorobenzohydrazide (PubChem CID 25143229) has the molecular formula C24H30F2N2O2 and a molecular weight of 416.51 g/mol. Its IUPAC name is N'-(3,5-dimethylbenzoyl)-N'-[(3S)-2,2-dimethylhexan-3-yl]-2,6-difluorobenzohydrazide.
| Compound Name | N'-(3,5-dimethylbenzoyl)-N'-[(3S)-2,2-dimethylhexan-3-yl]-2,6-difluorobenzohydrazide |
|---|---|
| PubChem CID | 25143229 |
| Molecular Formula | C24H30F2N2O2 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | N'-(3,5-dimethylbenzoyl)-N'-[(3S)-2,2-dimethylhexan-3-yl]-2,6-difluorobenzohydrazide |
| SMILES | CCC[C@H](N(NC(=O)c1c(F)cccc1F)C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C24H30F2N2O2/c1-7-9-20(24(4,5)6)28(23(30)17-13-15(2)12-16(3)14-17)27-22(29)21-18(25)10-8-11-19(21)26/h8,10-14,20H,7,9H2,1-6H3,(H,27,29)/t20-/m0/s1 |
| InChIKey | KWPSEIZPXTYILM-FQEVSTJZSA-N |
| XLogP | 5.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|