C22H30N2O2S — CID 74395745
N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylhexan-3-yl)thiophene-2-carbohydrazide (PubChem CID 74395745) has the molecular formula C22H30N2O2S and a molecular weight of 386.56 g/mol. Its IUPAC name is N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylhexan-3-yl)thiophene-2-carbohydrazide.
| Compound Name | N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylhexan-3-yl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 74395745 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylhexan-3-yl)thiophene-2-carbohydrazide |
| SMILES | CCCC(N(NC(=O)c1cccs1)C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C22H30N2O2S/c1-7-9-19(22(4,5)6)24(23-20(25)18-10-8-11-27-18)21(26)17-13-15(2)12-16(3)14-17/h8,10-14,19H,7,9H2,1-6H3,(H,23,25) |
| InChIKey | LNSZHBLKDVQZPO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|