C24H31ClN2O2 — CID 25143087
N'-(3-chlorobenzoyl)-N-[(3R)-2,2-dimethylhexan-3-yl]-3,5-dimethylbenzohydrazide (PubChem CID 25143087) has the molecular formula C24H31ClN2O2 and a molecular weight of 414.98 g/mol. Its IUPAC name is N'-(3-chlorobenzoyl)-N-[(3R)-2,2-dimethylhexan-3-yl]-3,5-dimethylbenzohydrazide.
| Compound Name | N'-(3-chlorobenzoyl)-N-[(3R)-2,2-dimethylhexan-3-yl]-3,5-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 25143087 |
| Molecular Formula | C24H31ClN2O2 |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N'-(3-chlorobenzoyl)-N-[(3R)-2,2-dimethylhexan-3-yl]-3,5-dimethylbenzohydrazide |
| SMILES | CCC[C@@H](N(NC(=O)c1cccc(Cl)c1)C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C24H31ClN2O2/c1-7-9-21(24(4,5)6)27(23(29)19-13-16(2)12-17(3)14-19)26-22(28)18-10-8-11-20(25)15-18/h8,10-15,21H,7,9H2,1-6H3,(H,26,28)/t21-/m1/s1 |
| InChIKey | JLECHVCCHKQGSK-OAQYLSRUSA-N |
| XLogP | 5.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|