C28H41BN2O5 — CID 90442184
3-[4-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylhexan-3-yl]amino]carbamoyl]-2-hydroxy-3-methylphenyl]propylboronic acid (PubChem CID 90442184) has the molecular formula C28H41BN2O5 and a molecular weight of 496.46 g/mol. Its IUPAC name is 3-[4-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylhexan-3-yl]amino]carbamoyl]-2-hydroxy-3-methylphenyl]propylboronic acid.
| Compound Name | 3-[4-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylhexan-3-yl]amino]carbamoyl]-2-hydroxy-3-methylphenyl]propylboronic acid |
|---|---|
| PubChem CID | 90442184 |
| Molecular Formula | C28H41BN2O5 |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | 3-[4-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylhexan-3-yl]amino]carbamoyl]-2-hydroxy-3-methylphenyl]propylboronic acid |
| SMILES | CCC[C@@H](N(NC(=O)c1ccc(CCCB(O)O)c(O)c1C)C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C28H41BN2O5/c1-8-10-24(28(5,6)7)31(27(34)22-16-18(2)15-19(3)17-22)30-26(33)23-13-12-21(25(32)20(23)4)11-9-14-29(35)36/h12-13,15-17,24,32,35-36H,8-11,14H2,1-7H3,(H,30,33)/t24-/m1/s1 |
| InChIKey | OBWNEOCIDVZYBK-XMMPIXPASA-N |
| XLogP | 4.72 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|