C28H34N2O2 — CID 25143499
N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylhexan-3-yl]naphthalene-1-carbohydrazide (PubChem CID 25143499) has the molecular formula C28H34N2O2 and a molecular weight of 430.59 g/mol. Its IUPAC name is N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylhexan-3-yl]naphthalene-1-carbohydrazide.
| Compound Name | N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylhexan-3-yl]naphthalene-1-carbohydrazide |
|---|---|
| PubChem CID | 25143499 |
| Molecular Formula | C28H34N2O2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylhexan-3-yl]naphthalene-1-carbohydrazide |
| SMILES | CCC[C@@H](N(NC(=O)c1cccc2ccccc12)C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C28H34N2O2/c1-7-11-25(28(4,5)6)30(27(32)22-17-19(2)16-20(3)18-22)29-26(31)24-15-10-13-21-12-8-9-14-23(21)24/h8-10,12-18,25H,7,11H2,1-6H3,(H,29,31)/t25-/m1/s1 |
| InChIKey | FELCFQOTRLGSGW-RUZDIDTESA-N |
| XLogP | 6.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|