C25H35BN2O4 — CID 86282612
[3-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylhexan-3-yl]amino]carbamoyl]-2-methylphenyl]boronic acid (PubChem CID 86282612) has the molecular formula C25H35BN2O4 and a molecular weight of 438.38 g/mol. Its IUPAC name is [3-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylhexan-3-yl]amino]carbamoyl]-2-methylphenyl]boronic acid.
| Compound Name | [3-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylhexan-3-yl]amino]carbamoyl]-2-methylphenyl]boronic acid |
|---|---|
| PubChem CID | 86282612 |
| Molecular Formula | C25H35BN2O4 |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | [3-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylhexan-3-yl]amino]carbamoyl]-2-methylphenyl]boronic acid |
| SMILES | CCC[C@@H](N(NC(=O)c1cccc(B(O)O)c1C)C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C25H35BN2O4/c1-8-10-22(25(5,6)7)28(24(30)19-14-16(2)13-17(3)15-19)27-23(29)20-11-9-12-21(18(20)4)26(31)32/h9,11-15,22,31-32H,8,10H2,1-7H3,(H,27,29)/t22-/m1/s1 |
| InChIKey | SNZYXUQSHMVSOG-JOCHJYFZSA-N |
| XLogP | 3.29 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|