C27H38N2O2 — CID 67498293
N-[(3S)-2,2-dimethylhexan-3-yl]-3,5-diethyl-N'-(2-methylbenzoyl)benzohydrazide (PubChem CID 67498293) has the molecular formula C27H38N2O2 and a molecular weight of 422.61 g/mol. Its IUPAC name is N-[(3S)-2,2-dimethylhexan-3-yl]-3,5-diethyl-N'-(2-methylbenzoyl)benzohydrazide.
| Compound Name | N-[(3S)-2,2-dimethylhexan-3-yl]-3,5-diethyl-N'-(2-methylbenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 67498293 |
| Molecular Formula | C27H38N2O2 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | N-[(3S)-2,2-dimethylhexan-3-yl]-3,5-diethyl-N'-(2-methylbenzoyl)benzohydrazide |
| SMILES | CCC[C@H](N(NC(=O)c1ccccc1C)C(=O)c1cc(CC)cc(CC)c1)C(C)(C)C |
| InChI | InChI=1S/C27H38N2O2/c1-8-13-24(27(5,6)7)29(28-25(30)23-15-12-11-14-19(23)4)26(31)22-17-20(9-2)16-21(10-3)18-22/h11-12,14-18,24H,8-10,13H2,1-7H3,(H,28,30)/t24-/m0/s1 |
| InChIKey | NJNQKGKAUPYLMN-DEOSSOPVSA-N |
| XLogP | 6.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|